Products 1621347-17-8
CAS 1621347-17-8 is the registry number for threo-1-(4-Hydroxyphenyl)-1-methoxy-2,3-propanediol. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R)-3-(4-hydroxyphenyl)-3-methoxypropane-1,2-diol (CAS 1621347-17-8) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: (2R,3R)-3-(4-hydroxyphenyl)-3-methoxypropane-1,2-diol. InChIKey: OIRWHGPQHATVNS-NXEZZACHSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | (2R,3R)-3-(4-hydroxyphenyl)-3-methoxypropane-1,2-diol |
| InChIKey | OIRWHGPQHATVNS-NXEZZACHSA-N |
| SMILES | CO[C@H](C1=CC=C(C=C1)O)[C@@H](CO)O |
Computed by PubChem (NCBI)