Products 162203-65-8
CAS 162203-65-8 is the registry number for JTP-4819. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-N-benzyl-2-[(2S)-2-(2-hydroxyacetyl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxamide (CAS 162203-65-8) is a chemical compound with the molecular formula C19H25N3O4 and a molecular weight of 359.4 g/mol. IUPAC name: (2S)-N-benzyl-2-[(2S)-2-(2-hydroxyacetyl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxamide. InChIKey: ICULFJDHZQTNRB-HOTGVXAUSA-N.
| Molecular formula | C19H25N3O4 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | (2S)-N-benzyl-2-[(2S)-2-(2-hydroxyacetyl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxamide |
| InChIKey | ICULFJDHZQTNRB-HOTGVXAUSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)[C@@H]2CCCN2C(=O)NCC3=CC=CC=C3)C(=O)CO |
Computed by PubChem (NCBI)