Products 162229-27-8
CAS 162229-27-8 appears in our catalog under these names: Dorsmanin A, Dorsmanin A, ≥98%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 25mg, 10mg, 50mg, Get quote, 5mg.
(E)-1-(5-hydroxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-3-(4-hydroxyphenyl)prop-2-en-1-one (CAS 162229-27-8) is a chemical compound with the molecular formula C20H20O4 and a molecular weight of 324.4 g/mol. IUPAC name: (E)-1-(5-hydroxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-3-(4-hydroxyphenyl)prop-2-en-1-one. InChIKey: UDSAJERKQRQHJR-WEVVVXLNSA-N.
| Molecular formula | C20H20O4 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | (E)-1-(5-hydroxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | UDSAJERKQRQHJR-WEVVVXLNSA-N |
| SMILES | CC1(CCC2=C(O1)C=CC(=C2O)C(=O)/C=C/C3=CC=C(C=C3)O)C |
Computed by PubChem (NCBI)