Products 1622329-00-3

CAS 1622329-00-3 is the registry number for tert-Butyl 3-acetylmorpholine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 3-acetylmorpholine-4-carboxylate (CAS 1622329-00-3) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: tert-butyl 3-acetylmorpholine-4-carboxylate. InChIKey: DLUVGYXVQLATAK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H19NO4
Molecular weight229.27 g/mol
IUPAC nametert-butyl 3-acetylmorpholine-4-carboxylate
InChIKeyDLUVGYXVQLATAK-UHFFFAOYSA-N
SMILESCC(=O)C1COCCN1C(=O)OC(C)(C)C

Computed by PubChem (NCBI)