Products 1622855-33-7

CAS 1622855-33-7 is the registry number for 1-(Cyclobutylmethyl)-5-methyl-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

1-(cyclobutylmethyl)-5-methylpyrazole-3-carboxylic acid (CAS 1622855-33-7) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: 1-(cyclobutylmethyl)-5-methylpyrazole-3-carboxylic acid. InChIKey: VHCDXUPQHLKNTI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14N2O2
Molecular weight194.23 g/mol
IUPAC name1-(cyclobutylmethyl)-5-methylpyrazole-3-carboxylic acid
InChIKeyVHCDXUPQHLKNTI-UHFFFAOYSA-N
SMILESCC1=CC(=NN1CC2CCC2)C(=O)O

Computed by PubChem (NCBI)