CAS 1623004-68-1 is the registry number for 1,3-Dimethyl-5-(2-(trifluoromethyl)phenoxy)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g.
1,3-dimethyl-5-[2-(trifluoromethyl)phenoxy]benzene (CAS 1623004-68-1) is a chemical compound with the molecular formula C15H13F3O and a molecular weight of 266.26 g/mol. IUPAC name: 1,3-dimethyl-5-[2-(trifluoromethyl)phenoxy]benzene. InChIKey: MECKCHJVPFUBQP-UHFFFAOYSA-N.
| Molecular formula | C15H13F3O |
|---|---|
| Molecular weight | 266.26 g/mol |
| IUPAC name | 1,3-dimethyl-5-[2-(trifluoromethyl)phenoxy]benzene |
| InChIKey | MECKCHJVPFUBQP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)OC2=CC=CC=C2C(F)(F)F)C |
Computed by PubChem (NCBI)