Products 194873-99-9
CAS 194873-99-9 is the registry number for 3′-(Trifluoromethyl)(1,1′-biphenyl)-4-ethanol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
2-[4-[3-(trifluoromethyl)phenyl]phenyl]ethanol (CAS 194873-99-9) is a chemical compound with the molecular formula C15H13F3O and a molecular weight of 266.26 g/mol. IUPAC name: 2-[4-[3-(trifluoromethyl)phenyl]phenyl]ethanol. InChIKey: RIRGMMRKSNLASS-UHFFFAOYSA-N.
| Molecular formula | C15H13F3O |
|---|---|
| Molecular weight | 266.26 g/mol |
| IUPAC name | 2-[4-[3-(trifluoromethyl)phenyl]phenyl]ethanol |
| InChIKey | RIRGMMRKSNLASS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=CC=C(C=C2)CCO |
Computed by PubChem (NCBI)