CAS 398126-85-7 is the registry number for 1-(4-Methoxybenzyl)-4-(trifluoromethyl)- benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1-methoxy-4-[[4-(trifluoromethyl)phenyl]methyl]benzene (CAS 398126-85-7) is a chemical compound with the molecular formula C15H13F3O and a molecular weight of 266.26 g/mol. IUPAC name: 1-methoxy-4-[[4-(trifluoromethyl)phenyl]methyl]benzene. InChIKey: YZWDXLYNDVQRLO-UHFFFAOYSA-N.
| Molecular formula | C15H13F3O |
|---|---|
| Molecular weight | 266.26 g/mol |
| IUPAC name | 1-methoxy-4-[[4-(trifluoromethyl)phenyl]methyl]benzene |
| InChIKey | YZWDXLYNDVQRLO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CC2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)