CAS 872258-58-7 appears in our catalog under these names: 2,6-Dimethyl-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-ol, 95%, 2,6-Dimethyl-4'-(trifluoromethyl)-(1,1'-biphenyl)-4-ol, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenol (CAS 872258-58-7) is a chemical compound with the molecular formula C15H13F3O and a molecular weight of 266.26 g/mol. IUPAC name: 3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenol. InChIKey: UAHZCJDIUCCRHT-UHFFFAOYSA-N.
| Molecular formula | C15H13F3O |
|---|---|
| Molecular weight | 266.26 g/mol |
| IUPAC name | 3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenol |
| InChIKey | UAHZCJDIUCCRHT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C2=CC=C(C=C2)C(F)(F)F)C)O |
Computed by PubChem (NCBI)