CAS 1623060-79-6 is the registry number for 5-(3-Methyl-5-phenyl-4H-1,2,4-triazol-4-yl)-1,3-benzenedicarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-(3-methyl-5-phenyl-1,2,4-triazol-4-yl)benzene-1,3-dicarboxylic acid (CAS 1623060-79-6) is a chemical compound with the molecular formula C17H13N3O4 and a molecular weight of 323.30 g/mol. IUPAC name: 5-(3-methyl-5-phenyl-1,2,4-triazol-4-yl)benzene-1,3-dicarboxylic acid. InChIKey: ZIOVOHBATNELQQ-UHFFFAOYSA-N.
| Molecular formula | C17H13N3O4 |
|---|---|
| Molecular weight | 323.30 g/mol |
| IUPAC name | 5-(3-methyl-5-phenyl-1,2,4-triazol-4-yl)benzene-1,3-dicarboxylic acid |
| InChIKey | ZIOVOHBATNELQQ-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(N1C2=CC(=CC(=C2)C(=O)O)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)