Products 458151-38-7
CAS 458151-38-7 is the registry number for CRBN ligand-678. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-amino-2-(2,6-dioxopiperidin-3-yl)benzo[de]isoquinoline-1,3-dione (CAS 458151-38-7) is a chemical compound with the molecular formula C17H13N3O4 and a molecular weight of 323.30 g/mol. IUPAC name: 5-amino-2-(2,6-dioxopiperidin-3-yl)benzo[de]isoquinoline-1,3-dione. InChIKey: AIQPKXWIKLCGGM-UHFFFAOYSA-N.
| Molecular formula | C17H13N3O4 |
|---|---|
| Molecular weight | 323.30 g/mol |
| IUPAC name | 5-amino-2-(2,6-dioxopiperidin-3-yl)benzo[de]isoquinoline-1,3-dione |
| InChIKey | AIQPKXWIKLCGGM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=CC=CC4=CC(=CC(=C43)C2=O)N |
Computed by PubChem (NCBI)