CAS 1623084-02-5 is the registry number for 5-Propyl-2-(1H-pyrrol-1-yl)-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-propyl-2-pyrrol-1-yl-1,3-thiazole-4-carboxylic acid (CAS 1623084-02-5) is a chemical compound with the molecular formula C11H12N2O2S and a molecular weight of 236.29 g/mol. IUPAC name: 5-propyl-2-pyrrol-1-yl-1,3-thiazole-4-carboxylic acid. InChIKey: RTKQKEBAAKXABJ-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | 5-propyl-2-pyrrol-1-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | RTKQKEBAAKXABJ-UHFFFAOYSA-N |
| SMILES | CCCC1=C(N=C(S1)N2C=CC=C2)C(=O)O |
Computed by PubChem (NCBI)