Products 1623084-02-5

CAS 1623084-02-5 is the registry number for 5-Propyl-2-(1H-pyrrol-1-yl)-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-propyl-2-pyrrol-1-yl-1,3-thiazole-4-carboxylic acid (CAS 1623084-02-5) is a chemical compound with the molecular formula C11H12N2O2S and a molecular weight of 236.29 g/mol. IUPAC name: 5-propyl-2-pyrrol-1-yl-1,3-thiazole-4-carboxylic acid. InChIKey: RTKQKEBAAKXABJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N2O2S
Molecular weight236.29 g/mol
IUPAC name5-propyl-2-pyrrol-1-yl-1,3-thiazole-4-carboxylic acid
InChIKeyRTKQKEBAAKXABJ-UHFFFAOYSA-N
SMILESCCCC1=C(N=C(S1)N2C=CC=C2)C(=O)O

Computed by PubChem (NCBI)