CAS 162536-46-1 is the registry number for Boc-L-Phe(3-OBzl)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 250mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-phenylmethoxyphenyl)propanoic acid (CAS 162536-46-1) is a chemical compound with the molecular formula C21H25NO5 and a molecular weight of 371.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-phenylmethoxyphenyl)propanoic acid. InChIKey: DQFJZTUNHOSBKT-SFHVURJKSA-N.
| Molecular formula | C21H25NO5 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-phenylmethoxyphenyl)propanoic acid |
| InChIKey | DQFJZTUNHOSBKT-SFHVURJKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=CC=C1)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)