Products 300771-47-5

CAS 300771-47-5 is the registry number for 3-((2-(4-(1,1-Dimethylethyl)phenoxy)acetyl)amino)benzoic Acid, Propyl Ester. Offered by: TRC. Available pack sizes: 2,5g.

Structural formula: {0} (CAS {1})

Propyl 3-[[2-(4-tert-butylphenoxy)acetyl]amino]benzoate (CAS 300771-47-5) is a chemical compound with the molecular formula C22H27NO4 and a molecular weight of 369.5 g/mol. IUPAC name: propyl 3-[[2-(4-tert-butylphenoxy)acetyl]amino]benzoate. InChIKey: LAZOKKTWSCWMKB-UHFFFAOYSA-N.

Identity
Molecular formulaC22H27NO4
Molecular weight369.5 g/mol
IUPAC namepropyl 3-[[2-(4-tert-butylphenoxy)acetyl]amino]benzoate
InChIKeyLAZOKKTWSCWMKB-UHFFFAOYSA-N
SMILESCCCOC(=O)C1=CC(=CC=C1)NC(=O)COC2=CC=C(C=C2)C(C)(C)C

Computed by PubChem (NCBI)