CAS 162542-01-0 appears in our catalog under these names: (5-Phenyl-1,3-oxazol-2-yl)methanol, 95%, (5-Phenyl-1,3-oxazol-2-yl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
(5-phenyl-1,3-oxazol-2-yl)methanol (CAS 162542-01-0) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: (5-phenyl-1,3-oxazol-2-yl)methanol. InChIKey: QWDFLHOXYNQZTE-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | (5-phenyl-1,3-oxazol-2-yl)methanol |
| InChIKey | QWDFLHOXYNQZTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(O2)CO |
Computed by PubChem (NCBI)