CAS 16255-53-1 is the registry number for 1-(tert-Butyl)-4-thiocyanatobenzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g.
(4-tert-butylphenyl) thiocyanate (CAS 16255-53-1) is a chemical compound with the molecular formula C11H13NS and a molecular weight of 191.29 g/mol. IUPAC name: (4-tert-butylphenyl) thiocyanate. InChIKey: QQLDSSBNOQWTOL-UHFFFAOYSA-N.
| Molecular formula | C11H13NS |
|---|---|
| Molecular weight | 191.29 g/mol |
| IUPAC name | (4-tert-butylphenyl) thiocyanate |
| InChIKey | QQLDSSBNOQWTOL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)SC#N |
Computed by PubChem (NCBI)