CAS 306935-86-4 is the registry number for 2-Isopropyl-6-methylphenyl isothiocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-isothiocyanato-1-methyl-3-propan-2-ylbenzene (CAS 306935-86-4) is a chemical compound with the molecular formula C11H13NS and a molecular weight of 191.29 g/mol. IUPAC name: 2-isothiocyanato-1-methyl-3-propan-2-ylbenzene. InChIKey: RDFPHTAQERHCES-UHFFFAOYSA-N.
| Molecular formula | C11H13NS |
|---|---|
| Molecular weight | 191.29 g/mol |
| IUPAC name | 2-isothiocyanato-1-methyl-3-propan-2-ylbenzene |
| InChIKey | RDFPHTAQERHCES-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(C)C)N=C=S |
Computed by PubChem (NCBI)