Products 17642-88-5
CAS 17642-88-5 appears in our catalog under these names: 1-Benzyl-2-pyrrolidinethione, 95%, 1–benzyl–2–pyrrolidinethione. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1-benzylpyrrolidine-2-thione (CAS 17642-88-5) is a chemical compound with the molecular formula C11H13NS and a molecular weight of 191.29 g/mol. IUPAC name: 1-benzylpyrrolidine-2-thione. InChIKey: QRUOAUZJVLZQIA-UHFFFAOYSA-N.
| Molecular formula | C11H13NS |
|---|---|
| Molecular weight | 191.29 g/mol |
| IUPAC name | 1-benzylpyrrolidine-2-thione |
| InChIKey | QRUOAUZJVLZQIA-UHFFFAOYSA-N |
| SMILES | C1CC(=S)N(C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)