CAS 939804-09-8 is the registry number for 6-(tert-Butyl)benzo[d]thiazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-tert-butyl-1,3-benzothiazole (CAS 939804-09-8) is a chemical compound with the molecular formula C11H13NS and a molecular weight of 191.29 g/mol. IUPAC name: 6-tert-butyl-1,3-benzothiazole. InChIKey: SMZWFDRXFKJJDV-UHFFFAOYSA-N.
| Molecular formula | C11H13NS |
|---|---|
| Molecular weight | 191.29 g/mol |
| IUPAC name | 6-tert-butyl-1,3-benzothiazole |
| InChIKey | SMZWFDRXFKJJDV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)N=CS2 |
Computed by PubChem (NCBI)