CAS 162612-08-0 appears in our catalog under these names: 5–Chloro–2,2'–bipyridine, 5-Chloro-2,2'-bipyridine 97%, 5-Chloro-2,2'-bipyridine, 97%, 97%, 5-Chloro-2,2'-bipyridine, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg, 5g.
5-chloro-2-pyridin-2-ylpyridine (CAS 162612-08-0) is a chemical compound with the molecular formula C10H7ClN2 and a molecular weight of 190.63 g/mol. IUPAC name: 5-chloro-2-pyridin-2-ylpyridine. InChIKey: LVLWWCDRDDNKHC-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2 |
|---|---|
| Molecular weight | 190.63 g/mol |
| IUPAC name | 5-chloro-2-pyridin-2-ylpyridine |
| InChIKey | LVLWWCDRDDNKHC-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC=C(C=C2)Cl |
Computed by PubChem (NCBI)