Products 1626336-78-4
CAS 1626336-78-4 is the registry number for 7-Bromo-4-methoxy-1-methyl-1H-indazol-3-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-4-methoxy-1-methylindazol-3-amine (CAS 1626336-78-4) is a chemical compound with the molecular formula C9H10BrN3O and a molecular weight of 256.10 g/mol. IUPAC name: 7-bromo-4-methoxy-1-methylindazol-3-amine. InChIKey: UTUIKRZNWPAJQC-UHFFFAOYSA-N.
| Molecular formula | C9H10BrN3O |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 7-bromo-4-methoxy-1-methylindazol-3-amine |
| InChIKey | UTUIKRZNWPAJQC-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2C(=N1)N)OC)Br |
Computed by PubChem (NCBI)