CAS 162705-57-9 is the registry number for 4-(Chloromethyl)-5-methyl-2-(naphthalen-2-yl)-1,3-oxazole. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(chloromethyl)-5-methyl-2-naphthalen-2-yl-1,3-oxazole (CAS 162705-57-9) is a chemical compound with the molecular formula C15H12ClNO and a molecular weight of 257.71 g/mol. IUPAC name: 4-(chloromethyl)-5-methyl-2-naphthalen-2-yl-1,3-oxazole. InChIKey: HMNCLDWXFRTEQR-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | 4-(chloromethyl)-5-methyl-2-naphthalen-2-yl-1,3-oxazole |
| InChIKey | HMNCLDWXFRTEQR-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC3=CC=CC=C3C=C2)CCl |
Computed by PubChem (NCBI)