CAS 33107-73-2 is the registry number for 1-(6-Chloro-9-methyl-9h-carbazol-3-yl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 1g, 5g.
1-(6-chloro-9-methylcarbazol-3-yl)ethanone (CAS 33107-73-2) is a chemical compound with the molecular formula C15H12ClNO and a molecular weight of 257.71 g/mol. IUPAC name: 1-(6-chloro-9-methylcarbazol-3-yl)ethanone. InChIKey: FILJOPWVEVEOOU-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | 1-(6-chloro-9-methylcarbazol-3-yl)ethanone |
| InChIKey | FILJOPWVEVEOOU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)N(C3=C2C=C(C=C3)Cl)C |
Computed by PubChem (NCBI)