Products 33948-19-5

CAS 33948-19-5 appears in our catalog under these names: Iminodibenzyl 5-Carbonyl Chloride, >95% (HPLC), Carbamazepine Impurity 12, 10,11-Dihydro-5H-dibenzo(b,f)azepine-5-carbonyl chloride, 98%, 10,11–Dihydro–5H–dibenzo(b,f)azepine–5–carbonyl Chloride, 10,11-Dihydro-5H-dibenzo[b,f]azepine-5-carbonyl Chloride, >98.0%(HPLC)(T). Offered by: TRC, Chemat Brand, AmBeed, GLPBio, TCI. Available pack sizes: 100mg, 10g, 1g, on request, 250mg, 25g, 5g, 100g.

Structural formula: {0} (CAS {1})

5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl chloride (CAS 33948-19-5) is a chemical compound with the molecular formula C15H12ClNO and a molecular weight of 257.71 g/mol. IUPAC name: 5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl chloride. InChIKey: COHHZMJBMIHLGF-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12ClNO
Molecular weight257.71 g/mol
IUPAC name5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl chloride
InChIKeyCOHHZMJBMIHLGF-UHFFFAOYSA-N
SMILESC1CC2=CC=CC=C2N(C3=CC=CC=C31)C(=O)Cl

Computed by PubChem (NCBI)