Products 192187-30-7
CAS 192187-30-7 is the registry number for 4-(3-Chlorophenyl)-3,4-dihydroquinolin-2(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3-chlorophenyl)-3,4-dihydro-1H-quinolin-2-one (CAS 192187-30-7) is a chemical compound with the molecular formula C15H12ClNO and a molecular weight of 257.71 g/mol. IUPAC name: 4-(3-chlorophenyl)-3,4-dihydro-1H-quinolin-2-one. InChIKey: KFDVRZXTYQSUSU-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | 4-(3-chlorophenyl)-3,4-dihydro-1H-quinolin-2-one |
| InChIKey | KFDVRZXTYQSUSU-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC=C2NC1=O)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)