CAS 1627181-42-3 appears in our catalog under these names: Rac-tert-butyl n-[(1r,3s)-3-aminocyclopentyl]carbamate hydrochloride, 95%, tert-Butyl ((1S,3R)-rel-3-aminocyclopentyl)carbamate hydrochloride, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg, 5g, 10g, 25g.
Tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate;hydrochloride (CAS 1627181-42-3) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate;hydrochloride. InChIKey: RYHBULZGXHADRD-KZYPOYLOSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate;hydrochloride |
| InChIKey | RYHBULZGXHADRD-KZYPOYLOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H](C1)N.Cl |
Computed by PubChem (NCBI)