CAS 2227743-71-5 appears in our catalog under these names: tert-Butyl ((1R,3S)-3-aminocyclopentyl)carbamate hydrochloride, 97%, tert-Butyl ((1R,3S)-3-aminocyclopentyl)carbamate hydrochloride, 97%, 97%, tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate,hydrochloride, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g, 25g.
Tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate;hydrochloride (CAS 2227743-71-5) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate;hydrochloride. InChIKey: RYHBULZGXHADRD-KZYPOYLOSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate;hydrochloride |
| InChIKey | RYHBULZGXHADRD-KZYPOYLOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H](C1)N.Cl |
Computed by PubChem (NCBI)