Products 1627712-50-8
CAS 1627712-50-8 is the registry number for 2-(3-(3-(Trifluoromethyl)-3H-diazirin-3-yl)phenyl)acetic acid, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 50mg, 100mg.
2-[3-[3-(trifluoromethyl)diazirin-3-yl]phenyl]acetic acid (CAS 1627712-50-8) is a chemical compound with the molecular formula C10H7F3N2O2 and a molecular weight of 244.17 g/mol. IUPAC name: 2-[3-[3-(trifluoromethyl)diazirin-3-yl]phenyl]acetic acid. InChIKey: AJLVFNXQKXPZOF-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2O2 |
|---|---|
| Molecular weight | 244.17 g/mol |
| IUPAC name | 2-[3-[3-(trifluoromethyl)diazirin-3-yl]phenyl]acetic acid |
| InChIKey | AJLVFNXQKXPZOF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2(N=N2)C(F)(F)F)CC(=O)O |
Computed by PubChem (NCBI)