Products 1627971-73-6
CAS 1627971-73-6 is the registry number for 4-((6-Bromo-1H-benzo[d]imidazol-1-yl)methyl)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(6-bromobenzimidazol-1-yl)methyl]thiane 1,1-dioxide (CAS 1627971-73-6) is a chemical compound with the molecular formula C13H15BrN2O2S and a molecular weight of 343.24 g/mol. IUPAC name: 4-[(6-bromobenzimidazol-1-yl)methyl]thiane 1,1-dioxide. InChIKey: IDEMNCXVNUILSM-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2O2S |
|---|---|
| Molecular weight | 343.24 g/mol |
| IUPAC name | 4-[(6-bromobenzimidazol-1-yl)methyl]thiane 1,1-dioxide |
| InChIKey | IDEMNCXVNUILSM-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1CN2C=NC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)