CAS 1949815-82-0 is the registry number for Ethyl 3-allyl-2-imino-2,3-dihydrobenzo[d]thiazole-6-carboxylate hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
Ethyl 2-imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate;hydrobromide (CAS 1949815-82-0) is a chemical compound with the molecular formula C13H15BrN2O2S and a molecular weight of 343.24 g/mol. IUPAC name: ethyl 2-imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate;hydrobromide. InChIKey: ABZSQSQCXSUCQG-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2O2S |
|---|---|
| Molecular weight | 343.24 g/mol |
| IUPAC name | ethyl 2-imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate;hydrobromide |
| InChIKey | ABZSQSQCXSUCQG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)N(C(=N)S2)CC=C.Br |
Computed by PubChem (NCBI)