Products 2245166-00-9
CAS 2245166-00-9 is the registry number for tert-Butyl ((5-bromobenzo[d]thiazol-2-yl)methyl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(5-bromo-1,3-benzothiazol-2-yl)methyl]carbamate (CAS 2245166-00-9) is a chemical compound with the molecular formula C13H15BrN2O2S and a molecular weight of 343.24 g/mol. IUPAC name: tert-butyl N-[(5-bromo-1,3-benzothiazol-2-yl)methyl]carbamate. InChIKey: CFBMTUOHHGVUIR-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2O2S |
|---|---|
| Molecular weight | 343.24 g/mol |
| IUPAC name | tert-butyl N-[(5-bromo-1,3-benzothiazol-2-yl)methyl]carbamate |
| InChIKey | CFBMTUOHHGVUIR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=NC2=C(S1)C=CC(=C2)Br |
Computed by PubChem (NCBI)