CAS 936840-32-3 is the registry number for tert-Butyl (4-(bromomethyl)benzo(d)thiazol-2-yl)carbamate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl N-[4-(bromomethyl)-1,3-benzothiazol-2-yl]carbamate (CAS 936840-32-3) is a chemical compound with the molecular formula C13H15BrN2O2S and a molecular weight of 343.24 g/mol. IUPAC name: tert-butyl N-[4-(bromomethyl)-1,3-benzothiazol-2-yl]carbamate. InChIKey: PUWKMKJPJFODHL-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2O2S |
|---|---|
| Molecular weight | 343.24 g/mol |
| IUPAC name | tert-butyl N-[4-(bromomethyl)-1,3-benzothiazol-2-yl]carbamate |
| InChIKey | PUWKMKJPJFODHL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC2=C(C=CC=C2S1)CBr |
Computed by PubChem (NCBI)