CAS 1628073-10-8 is the registry number for 9-Bromobenzo[b]naphtho[1,2-d]thiophene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
9-bromonaphtho[2,1-b][1]benzothiole (CAS 1628073-10-8) is a chemical compound with the molecular formula C16H9BrS and a molecular weight of 313.2 g/mol. IUPAC name: 9-bromonaphtho[2,1-b][1]benzothiole. InChIKey: IHRVTRYOZCYBHJ-UHFFFAOYSA-N.
| Molecular formula | C16H9BrS |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | 9-bromonaphtho[2,1-b][1]benzothiole |
| InChIKey | IHRVTRYOZCYBHJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=C(S3)C=C(C=C4)Br |
Computed by PubChem (NCBI)