CAS 1799411-66-7 is the registry number for 3-Bromobenzo[kl]thioxanthene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
14-bromo-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene (CAS 1799411-66-7) is a chemical compound with the molecular formula C16H9BrS and a molecular weight of 313.2 g/mol. IUPAC name: 14-bromo-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene. InChIKey: JMRNZSPITCBQMI-UHFFFAOYSA-N.
| Molecular formula | C16H9BrS |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | 14-bromo-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene |
| InChIKey | JMRNZSPITCBQMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C4C(=C(C=C3)Br)C=CC=C4S2 |
Computed by PubChem (NCBI)