CAS 189097-35-6 appears in our catalog under these names: 5-Bromobenzo[b]naphtho[1,2-d]thiophene, >97.0%(GC), 5-Bromobenzo[b]naphtho[1,2-d]thiophene, 96%, 96%, 5-Bromobenzo[b]naphtho[1,2-d]thiophene, 97%. Offered by: TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg.
5-bromonaphtho[2,1-b][1]benzothiole (CAS 189097-35-6) is a chemical compound with the molecular formula C16H9BrS and a molecular weight of 313.2 g/mol. IUPAC name: 5-bromonaphtho[2,1-b][1]benzothiole. InChIKey: QVRGGAUEEZOTCD-UHFFFAOYSA-N.
| Molecular formula | C16H9BrS |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | 5-bromonaphtho[2,1-b][1]benzothiole |
| InChIKey | QVRGGAUEEZOTCD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC3=C2C4=CC=CC=C4S3)Br |
Computed by PubChem (NCBI)