CAS 1628073-12-0 is the registry number for 10-Bromobenzo[b]naphtho[2,1-d]thiophene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
10-bromonaphtho[1,2-b][1]benzothiole (CAS 1628073-12-0) is a chemical compound with the molecular formula C16H9BrS and a molecular weight of 313.2 g/mol. IUPAC name: 10-bromonaphtho[1,2-b][1]benzothiole. InChIKey: UHYDMPBXKCTGTL-UHFFFAOYSA-N.
| Molecular formula | C16H9BrS |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | 10-bromonaphtho[1,2-b][1]benzothiole |
| InChIKey | UHYDMPBXKCTGTL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2SC4=C3C=CC=C4Br |
Computed by PubChem (NCBI)