Products 1628112-69-5
CAS 1628112-69-5 appears in our catalog under these names: (±)–Cannabichromevarinic Acid (CRM), (±)-Cannabichromevarinic acid, Cannabichromevarinic acid (cbcva). Offered by: GLPBio, Biosynth, Supelco. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, 1ML.
5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propylchromene-6-carboxylic acid (CAS 1628112-69-5) is a chemical compound with the molecular formula C20H26O4 and a molecular weight of 330.4 g/mol. IUPAC name: 5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propylchromene-6-carboxylic acid. InChIKey: OIVPAQDCMDYIIL-UHFFFAOYSA-N.
| Molecular formula | C20H26O4 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propylchromene-6-carboxylic acid |
| InChIKey | OIVPAQDCMDYIIL-UHFFFAOYSA-N |
| SMILES | CCCC1=CC2=C(C=CC(O2)(C)CCC=C(C)C)C(=C1C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Cannabichromevarinic acid, CBCVA, (+/-)-Cannabichromevarinic Acid, orb1992158, (?)-Cannabichromevarinic Acid (CRM), 5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propyl-chromene-6-carboxylic Acid, Cannabichromevarinic acid (CBCVA) 100 |Ig/mL in Acetonitrile, Cannabichromevarinic acid (CBCVA) 1000 |Ig/mL in Acetonitrile, Cannabichromevarinic acid (CBCVA) 100 microg/mL in Acetonitrile, Cannabichromevarinic acid (CBCVA) 1000 microg/mL in Acetonitrile