Products 1628546-77-9
CAS 1628546-77-9 is the registry number for 6-(Trifluoromethyl)benzo[b]thiophen-2-amine, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 50mg, 100mg.
6-(trifluoromethyl)-1-benzothiophen-2-amine (CAS 1628546-77-9) is a chemical compound with the molecular formula C9H6F3NS and a molecular weight of 217.21 g/mol. IUPAC name: 6-(trifluoromethyl)-1-benzothiophen-2-amine. InChIKey: AGFTUDHGNHNXQR-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NS |
|---|---|
| Molecular weight | 217.21 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1-benzothiophen-2-amine |
| InChIKey | AGFTUDHGNHNXQR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)SC(=C2)N |
Computed by PubChem (NCBI)