Products 1628714-23-7
CAS 1628714-23-7 is the registry number for 1-Chloro-4-(2,2-difluorocyclopropyl)benzene, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-chloro-4-(2,2-difluorocyclopropyl)benzene (CAS 1628714-23-7) is a chemical compound with the molecular formula C9H7ClF2 and a molecular weight of 188.60 g/mol. IUPAC name: 1-chloro-4-(2,2-difluorocyclopropyl)benzene. InChIKey: PDSPOOKYQKWOBA-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2 |
|---|---|
| Molecular weight | 188.60 g/mol |
| IUPAC name | 1-chloro-4-(2,2-difluorocyclopropyl)benzene |
| InChIKey | PDSPOOKYQKWOBA-UHFFFAOYSA-N |
| SMILES | C1C(C1(F)F)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)