Products 1628841-12-2
CAS 1628841-12-2 is the registry number for 4-Methyl-2-(1H-1,2,3-triazol-1-yl)benzoic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-methyl-2-(triazol-1-yl)benzoic acid (CAS 1628841-12-2) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 4-methyl-2-(triazol-1-yl)benzoic acid. InChIKey: JGHYCQWNTXEKQE-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 4-methyl-2-(triazol-1-yl)benzoic acid |
| InChIKey | JGHYCQWNTXEKQE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)O)N2C=CN=N2 |
Computed by PubChem (NCBI)