CAS 13613-65-5 appears in our catalog under these names: (R)-(-)-3-Hydroxybutyric Acid Sodium Salt, (R)–3–Hydroxybutanoic acid sodium, (R)-3-Hydroxybutanoic acid sodium, (R)-3-Hydroxybutyric acid sodium, (R)-(-)-3-HYDROXYBUTYRIC ACID SODIUM SAL. Offered by: TRC, GLPBio, TargetMol, Biosynth, Sigma-Aldrich. Available pack sizes: 10g, 1g, 25g, 10mM (in 1ml dmso), 500mg, 250g, 500g, 1000g.
Sodium (3R)-3-hydroxybutanoate (CAS 13613-65-5) is a chemical compound with the molecular formula C4H7NaO3 and a molecular weight of 126.09 g/mol. IUPAC name: sodium (3R)-3-hydroxybutanoate. InChIKey: NBPUSGBJDWCHKC-AENDTGMFSA-M.
| Molecular formula | C4H7NaO3 |
|---|---|
| Molecular weight | 126.09 g/mol |
| IUPAC name | sodium (3R)-3-hydroxybutanoate |
| InChIKey | NBPUSGBJDWCHKC-AENDTGMFSA-M |
| SMILES | C[C@H](CC(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)