Products 1246814-85-6
CAS 1246814-85-6 is the registry number for 4-Hydroxybutyric Acid-13C4 Sodium Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 1mg.
Sodium 4-hydroxy(1,2,3,4-13C4)butanoate (CAS 1246814-85-6) is a chemical compound with the molecular formula C4H7NaO3 and a molecular weight of 130.057 g/mol. IUPAC name: sodium 4-hydroxy(1,2,3,4-13C4)butanoate. InChIKey: XYGBKMMCQDZQOZ-UJNKEPEOSA-M.
| Molecular formula | C4H7NaO3 |
|---|---|
| Molecular weight | 130.057 g/mol |
| IUPAC name | sodium 4-hydroxy(1,2,3,4-13C4)butanoate |
| InChIKey | XYGBKMMCQDZQOZ-UJNKEPEOSA-M |
| SMILES | [13CH2]([13CH2][13C](=O)[O-])[13CH2]O.[Na+] |
Computed by PubChem (NCBI)
Synonyms:
4-Hydroxybutyric Acid-13C4 Sodium Salt