CAS 16297-98-6 is the registry number for 3,3'-(3H-Diazirine-3,3-diyl)dipropionic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-[3-(2-carboxyethyl)diazirin-3-yl]propanoic acid (CAS 16297-98-6) is a chemical compound with the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. IUPAC name: 3-[3-(2-carboxyethyl)diazirin-3-yl]propanoic acid. InChIKey: LKAGNZVMUBAGEA-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O4 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 3-[3-(2-carboxyethyl)diazirin-3-yl]propanoic acid |
| InChIKey | LKAGNZVMUBAGEA-UHFFFAOYSA-N |
| SMILES | C(CC1(N=N1)CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)