CAS 1631-26-1 appears in our catalog under these names: 1-Benzylpyrrole-2,5-dione 98%, 1-Benzylpyrrole-2,5-dione, 99.96%, Benzylmaleimide, N–Benzylmaleimide, N-Benzylmaleimide/ 98%. Offered by: Ambeed, MedChemExpress, TRC, GLPBio, Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 100 g, 10g, 50g.
1-benzylpyrrole-2,5-dione (CAS 1631-26-1) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 1-benzylpyrrole-2,5-dione. InChIKey: MKRBAPNEJMFMHU-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 1-benzylpyrrole-2,5-dione |
| InChIKey | MKRBAPNEJMFMHU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)