CAS 1631-28-3 appears in our catalog under these names: 1-(4-Methylphenyl)-1h-pyrrole-2,5-dione, 95%, p-Tolylmaleimide/ 98.69% (existing batch purity), p–Tolylmaleimide, 1-(p-Tolyl)-1H-pyrrole-2,5-dione, >98.0%(GC), p-Tolylmaleimide 95%. Offered by: Combi-blocks, TargetMol, GLPBio, TCI, Ambeed. Available pack sizes: 5g, 250mg, 1g, 5mg, 10mg, 25mg, 50mg, 100mg.
1-(4-methylphenyl)pyrrole-2,5-dione (CAS 1631-28-3) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 1-(4-methylphenyl)pyrrole-2,5-dione. InChIKey: KCFXNGDHQPMIAQ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 1-(4-methylphenyl)pyrrole-2,5-dione |
| InChIKey | KCFXNGDHQPMIAQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)