Products 1632152-01-2

CAS 1632152-01-2 is the registry number for tert-Butyl N-(7-oxooxepan-4-yl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(7-oxooxepan-4-yl)carbamate (CAS 1632152-01-2) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: tert-butyl N-(7-oxooxepan-4-yl)carbamate. InChIKey: XVZXEVNLPPLQOM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H19NO4
Molecular weight229.27 g/mol
IUPAC nametert-butyl N-(7-oxooxepan-4-yl)carbamate
InChIKeyXVZXEVNLPPLQOM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CCC(=O)OCC1

Computed by PubChem (NCBI)