Products 163269-30-5
CAS 163269-30-5 appears in our catalog under these names: Bethoxazin, >95% (HPLC), Bethoxazin/ 98%, Bethoxazin, 98.45%. Offered by: TRC, TargetMol, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 25mg, 50mg, 100mg, 5 mg.
3-(1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide (CAS 163269-30-5) is a chemical compound with the molecular formula C11H9NO2S2 and a molecular weight of 251.3 g/mol. IUPAC name: 3-(1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide. InChIKey: NRAYWXLNSHEHQO-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S2 |
|---|---|
| Molecular weight | 251.3 g/mol |
| IUPAC name | 3-(1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide |
| InChIKey | NRAYWXLNSHEHQO-UHFFFAOYSA-N |
| SMILES | C1CS(=O)C(=NO1)C2=CC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)
Synonyms:
Bethoxazin, Bethogard, Bethoguard, Bethoxazin [ISO], 3-(benzo[b]thien-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide, 3-(1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide, 1,4,2-Oxathiazine, 3-benzo[b]thien-2-yl-5,6-dihydro-, 4-oxide, MICROBAN ADDITIVE GBF, orb1299721, NRAYWXLNSHEHQO-UHFFFAOYSA-N