CAS 930395-77-0 appears in our catalog under these names: 2-[(1,3-Thiazol-4-ylmethyl)thio]benzoic acid, 95%, 2-((1,3-Thiazol-4-ylmethyl)sulfanyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(1,3-thiazol-4-ylmethylsulfanyl)benzoic acid (CAS 930395-77-0) is a chemical compound with the molecular formula C11H9NO2S2 and a molecular weight of 251.3 g/mol. IUPAC name: 2-(1,3-thiazol-4-ylmethylsulfanyl)benzoic acid. InChIKey: HSRAXHLVOYBBFL-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S2 |
|---|---|
| Molecular weight | 251.3 g/mol |
| IUPAC name | 2-(1,3-thiazol-4-ylmethylsulfanyl)benzoic acid |
| InChIKey | HSRAXHLVOYBBFL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)SCC2=CSC=N2 |
Computed by PubChem (NCBI)