CAS 81154-16-7 is the registry number for (5E)-2-Mercapto-5-(4-methoxybenzylidene)-1,3-thiazol-4(5h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(5E)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 81154-16-7) is a chemical compound with the molecular formula C11H9NO2S2 and a molecular weight of 251.3 g/mol. IUPAC name: (5E)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: ORGCJYCWFZQEFX-RMKNXTFCSA-N.
| Molecular formula | C11H9NO2S2 |
|---|---|
| Molecular weight | 251.3 g/mol |
| IUPAC name | (5E)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | ORGCJYCWFZQEFX-RMKNXTFCSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/2\C(=O)NC(=S)S2 |
Computed by PubChem (NCBI)