Products 488733-52-4

CAS 488733-52-4 is the registry number for 4-Methyl-3-phenyl-2-thioxo-2,3-dihydro-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-methyl-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxylic acid (CAS 488733-52-4) is a chemical compound with the molecular formula C11H9NO2S2 and a molecular weight of 251.3 g/mol. IUPAC name: 4-methyl-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxylic acid. InChIKey: WMNTVZQDOLJKNS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO2S2
Molecular weight251.3 g/mol
IUPAC name4-methyl-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxylic acid
InChIKeyWMNTVZQDOLJKNS-UHFFFAOYSA-N
SMILESCC1=C(SC(=S)N1C2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)