CAS 488733-52-4 is the registry number for 4-Methyl-3-phenyl-2-thioxo-2,3-dihydro-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-methyl-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxylic acid (CAS 488733-52-4) is a chemical compound with the molecular formula C11H9NO2S2 and a molecular weight of 251.3 g/mol. IUPAC name: 4-methyl-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxylic acid. InChIKey: WMNTVZQDOLJKNS-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S2 |
|---|---|
| Molecular weight | 251.3 g/mol |
| IUPAC name | 4-methyl-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxylic acid |
| InChIKey | WMNTVZQDOLJKNS-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=S)N1C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)